C30H22BF12NO3 — CID 139772610
[5-bis(2,3,4-trifluorophenoxy)boranyloxy-2,3,4-trifluorophenyl]-triethylazanium;1,2,3-trifluorobenzene-6-ide (PubChem CID 139772610) has the molecular formula C30H22BF12NO3 and a molecular weight of 683.30 g/mol. Its IUPAC name is [5-bis(2,3,4-trifluorophenoxy)boranyloxy-2,3,4-trifluorophenyl]-triethylazanium;1,2,3-trifluorobenzene-6-ide.
| Compound Name | [5-bis(2,3,4-trifluorophenoxy)boranyloxy-2,3,4-trifluorophenyl]-triethylazanium;1,2,3-trifluorobenzene-6-ide |
|---|---|
| PubChem CID | 139772610 |
| Molecular Formula | C30H22BF12NO3 |
| Molecular Weight | 683.30 g/mol |
| Exact Mass | 683.15 |
| IUPAC Name | [5-bis(2,3,4-trifluorophenoxy)boranyloxy-2,3,4-trifluorophenyl]-triethylazanium;1,2,3-trifluorobenzene-6-ide |
| SMILES | CC[N+](CC)(CC)c1cc(OB(Oc2ccc(F)c(F)c2F)Oc2ccc(F)c(F)c2F)c(F)c(F)c1F.Fc1[c-]ccc(F)c1F |
| InChI | InChI=1S/C24H20BF9NO3.C6H2F3/c1-4-35(5-2,6-3)14-11-17(23(33)24(34)20(14)30)38-25(36-15-9-7-12(26)18(28)21(15)31)37-16-10-8-13(27)19(29)22(16)32;7-4-2-1-3-5(8)6(4)9/h7-11H,4-6H2,1-3H3;1-2H/q+1;-1 |
| InChIKey | YOWJYJWYARJOKT-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.30 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|