C9H16N6O2 — CID 139772646
4-(2,6-dimethylmorpholin-4-yl)-1-hydroxy-6-imino-1,3,5-triazin-2-amine (PubChem CID 139772646) has the molecular formula C9H16N6O2 and a molecular weight of 240.27 g/mol. Its IUPAC name is 4-(2,6-dimethylmorpholin-4-yl)-1-hydroxy-6-imino-1,3,5-triazin-2-amine.
| Compound Name | 4-(2,6-dimethylmorpholin-4-yl)-1-hydroxy-6-imino-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 139772646 |
| Molecular Formula | C9H16N6O2 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 4-(2,6-dimethylmorpholin-4-yl)-1-hydroxy-6-imino-1,3,5-triazin-2-amine |
| SMILES | [H]/N=c1\nc(N2CC(C)OC(C)C2)nc(N)n1O |
| InChI | InChI=1S/C9H16N6O2/c1-5-3-14(4-6(2)17-5)9-12-7(10)15(16)8(11)13-9/h5-6,16H,3-4H2,1-2H3,(H3,10,11,12,13) |
| InChIKey | LWHXVIHWDBWTMP-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|