C25H32ClNO2 — CID 139774918
1-[2,6-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-3-(2-ethylphenyl)prop-2-en-1-one;hydrochloride (PubChem CID 139774918) has the molecular formula C25H32ClNO2 and a molecular weight of 413.99 g/mol. Its IUPAC name is 1-[2,6-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-3-(2-ethylphenyl)prop-2-en-1-one;hydrochloride.
| Compound Name | 1-[2,6-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-3-(2-ethylphenyl)prop-2-en-1-one;hydrochloride |
|---|---|
| PubChem CID | 139774918 |
| Molecular Formula | C25H32ClNO2 |
| Molecular Weight | 413.99 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 1-[2,6-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-3-(2-ethylphenyl)prop-2-en-1-one;hydrochloride |
| SMILES | CCc1ccccc1C=CC(=O)c1c(C)cc(OCCN2CCCC2)cc1C.Cl |
| InChI | InChI=1S/C25H31NO2.ClH/c1-4-21-9-5-6-10-22(21)11-12-24(27)25-19(2)17-23(18-20(25)3)28-16-15-26-13-7-8-14-26;/h5-6,9-12,17-18H,4,7-8,13-16H2,1-3H3;1H |
| InChIKey | TZFXQWSTDQLPFR-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.99 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|