C23H25N3O5 — CID 139776290
ethyl 3-[[3-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]-2-pyridinyl]amino]-2-cyanoprop-2-enoate (PubChem CID 139776290) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is ethyl 3-[[3-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]-2-pyridinyl]amino]-2-cyanoprop-2-enoate.
| Compound Name | ethyl 3-[[3-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]-2-pyridinyl]amino]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 139776290 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | ethyl 3-[[3-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]-2-pyridinyl]amino]-2-cyanoprop-2-enoate |
| SMILES | CCCc1c(OCc2cccnc2NC=C(C#N)C(=O)OCC)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C23H25N3O5/c1-4-7-19-20(10-9-18(15(3)27)21(19)28)31-14-16-8-6-11-25-22(16)26-13-17(12-24)23(29)30-5-2/h6,8-11,13,28H,4-5,7,14H2,1-3H3,(H,25,26) |
| InChIKey | ANRPESIEYLJKQU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|