C15H16O5S — CID 139784485
4-[(4-hydroxyphenyl)sulfanyloxymethyl]-2,6-dimethoxyphenol (PubChem CID 139784485) has the molecular formula C15H16O5S and a molecular weight of 308.36 g/mol. Its IUPAC name is 4-[(4-hydroxyphenyl)sulfanyloxymethyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(4-hydroxyphenyl)sulfanyloxymethyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 139784485 |
| Molecular Formula | C15H16O5S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 4-[(4-hydroxyphenyl)sulfanyloxymethyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(COSc2ccc(O)cc2)cc(OC)c1O |
| InChI | InChI=1S/C15H16O5S/c1-18-13-7-10(8-14(19-2)15(13)17)9-20-21-12-5-3-11(16)4-6-12/h3-8,16-17H,9H2,1-2H3 |
| InChIKey | RHQYVWBZJRBDHW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|