C12H13Cl2NO3 — CID 139786259
methyl 2,4-dichloro-3-(N-ethoxy-C-methylcarbonimidoyl)benzoate (PubChem CID 139786259) has the molecular formula C12H13Cl2NO3 and a molecular weight of 290.15 g/mol. Its IUPAC name is methyl 2,4-dichloro-3-(N-ethoxy-C-methylcarbonimidoyl)benzoate.
| Compound Name | methyl 2,4-dichloro-3-(N-ethoxy-C-methylcarbonimidoyl)benzoate |
|---|---|
| PubChem CID | 139786259 |
| Molecular Formula | C12H13Cl2NO3 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | methyl 2,4-dichloro-3-(N-ethoxy-C-methylcarbonimidoyl)benzoate |
| SMILES | CCON=C(C)c1c(Cl)ccc(C(=O)OC)c1Cl |
| InChI | InChI=1S/C12H13Cl2NO3/c1-4-18-15-7(2)10-9(13)6-5-8(11(10)14)12(16)17-3/h5-6H,4H2,1-3H3 |
| InChIKey | MIPVWGGQXYKNBI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|