methyl 2,4-dichloro-3-(N-ethoxy-C-methylcarbonimidoyl)benzoate

C12H13Cl2NO3 — CID 139786259

IUPACmethyl 2,4-dichloro-3-(N-ethoxy-C-methylcarbonimidoyl)benzoate
SMILESCCON=C(C)c1c(Cl)ccc(C(=O)OC)c1Cl
InChIInChI=1S/C12H13Cl2NO3/c1-4-18-15-7(2)10-9(13)6-5-8(11(10)14)12(16)17-3/h5-6H,4H2,1-3H3
InChIKeyMIPVWGGQXYKNBI-UHFFFAOYSA-N
MW290.15 g/mol
LogP3.54
Rot. Bonds4

About methyl 2,4-dichloro-3-(N-ethoxy-C-methylcarbonimidoyl)benzoate

methyl 2,4-dichloro-3-(N-ethoxy-C-methylcarbonimidoyl)benzoate (PubChem CID 139786259) has the molecular formula C12H13Cl2NO3 and a molecular weight of 290.15 g/mol. Its IUPAC name is methyl 2,4-dichloro-3-(N-ethoxy-C-methylcarbonimidoyl)benzoate.

Molecular Properties

Compound Namemethyl 2,4-dichloro-3-(N-ethoxy-C-methylcarbonimidoyl)benzoate
PubChem CID139786259
Molecular FormulaC12H13Cl2NO3
Molecular Weight290.15 g/mol
Exact Mass289.03
IUPAC Namemethyl 2,4-dichloro-3-(N-ethoxy-C-methylcarbonimidoyl)benzoate
SMILESCCON=C(C)c1c(Cl)ccc(C(=O)OC)c1Cl
InChIInChI=1S/C12H13Cl2NO3/c1-4-18-15-7(2)10-9(13)6-5-8(11(10)14)12(16)17-3/h5-6H,4H2,1-3H3
InChIKeyMIPVWGGQXYKNBI-UHFFFAOYSA-N
XLogP3.54
TPSA47.89 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.15
LogP ≤ 53.54
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 2,4-dichloro-3-(N-ethoxy-C-methylcarbonimidoyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,4-dichloro-3-(N-ethoxy-C-methylcarbonimidoyl)benzoate?
The IUPAC name of methyl 2,4-dichloro-3-(N-ethoxy-C-methylcarbonimidoyl)benzoate (CID 139786259) is methyl 2,4-dichloro-3-(N-ethoxy-C-methylcarbonimidoyl)benzoate.
What is the SMILES notation for methyl 2,4-dichloro-3-(N-ethoxy-C-methylcarbonimidoyl)benzoate?
The canonical SMILES for methyl 2,4-dichloro-3-(N-ethoxy-C-methylcarbonimidoyl)benzoate is CCON=C(C)c1c(Cl)ccc(C(=O)OC)c1Cl.
What is the InChIKey of methyl 2,4-dichloro-3-(N-ethoxy-C-methylcarbonimidoyl)benzoate?
The InChIKey is MIPVWGGQXYKNBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Cl2NO3/c1-4-18-15-7(2)10-9(13)6-5-8(11(10)14)12(16)17-3/h5-6H,4H2,1-3H3.
What are the key properties of methyl 2,4-dichloro-3-(N-ethoxy-C-methylcarbonimidoyl)benzoate?
methyl 2,4-dichloro-3-(N-ethoxy-C-methylcarbonimidoyl)benzoate has a molecular weight of 290.15 g/mol, XLogP of 3.54, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,4-dichloro-3-(N-ethoxy-C-methylcarbonimidoyl)benzoate is sourced from PubChem (CID 139786259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).