C34H30N4O3 — CID 139790014
2,5-bis[4-[(4-aminophenyl)methyl]phenyl]-4-hydroxybenzene-1,3-dicarboxamide (PubChem CID 139790014) has the molecular formula C34H30N4O3 and a molecular weight of 542.64 g/mol. Its IUPAC name is 2,5-bis[4-[(4-aminophenyl)methyl]phenyl]-4-hydroxybenzene-1,3-dicarboxamide.
| Compound Name | 2,5-bis[4-[(4-aminophenyl)methyl]phenyl]-4-hydroxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 139790014 |
| Molecular Formula | C34H30N4O3 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | 2,5-bis[4-[(4-aminophenyl)methyl]phenyl]-4-hydroxybenzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1cc(-c2ccc(Cc3ccc(N)cc3)cc2)c(O)c(C(N)=O)c1-c1ccc(Cc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C34H30N4O3/c35-26-13-5-22(6-14-26)17-20-1-9-24(10-2-20)28-19-29(33(37)40)30(31(32(28)39)34(38)41)25-11-3-21(4-12-25)18-23-7-15-27(36)16-8-23/h1-16,19,39H,17-18,35-36H2,(H2,37,40)(H2,38,41) |
| InChIKey | AZFIOTDIMRUHGZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 158.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|