C27H27ClN2O4S — CID 139790513
7-[2-[(4-chlorophenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]-7-pyridin-3-ylhept-2-enoic acid (PubChem CID 139790513) has the molecular formula C27H27ClN2O4S and a molecular weight of 511.04 g/mol. Its IUPAC name is 7-[2-[(4-chlorophenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]-7-pyridin-3-ylhept-2-enoic acid.
| Compound Name | 7-[2-[(4-chlorophenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]-7-pyridin-3-ylhept-2-enoic acid |
|---|---|
| PubChem CID | 139790513 |
| Molecular Formula | C27H27ClN2O4S |
| Molecular Weight | 511.04 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 7-[2-[(4-chlorophenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]-7-pyridin-3-ylhept-2-enoic acid |
| SMILES | O=C(O)C=CCCCC(c1cccnc1)c1ccc2c(c1)CC(NS(=O)(=O)c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C27H27ClN2O4S/c28-23-10-12-25(13-11-23)35(33,34)30-24-16-19-8-9-20(15-22(19)17-24)26(21-5-4-14-29-18-21)6-2-1-3-7-27(31)32/h3-5,7-15,18,24,26,30H,1-2,6,16-17H2,(H,31,32) |
| InChIKey | KIXIBPAOSCWPNR-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.04 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|