C17H14N2OS — CID 139791433
1-amino-3,5-diphenyl-4-sulfanylpyridin-2-one (PubChem CID 139791433) has the molecular formula C17H14N2OS and a molecular weight of 294.38 g/mol. Its IUPAC name is 1-amino-3,5-diphenyl-4-sulfanylpyridin-2-one.
| Compound Name | 1-amino-3,5-diphenyl-4-sulfanylpyridin-2-one |
|---|---|
| PubChem CID | 139791433 |
| Molecular Formula | C17H14N2OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 1-amino-3,5-diphenyl-4-sulfanylpyridin-2-one |
| SMILES | Nn1cc(-c2ccccc2)c(S)c(-c2ccccc2)c1=O |
| InChI | InChI=1S/C17H14N2OS/c18-19-11-14(12-7-3-1-4-8-12)16(21)15(17(19)20)13-9-5-2-6-10-13/h1-11,21H,18H2 |
| InChIKey | MFMWQRAZDPYTFM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|