C14H18O6 — CID 139792938
2-[4-(1,4-dioxopent-1-en-2-yloxy)butoxy]pent-1-ene-1,4-dione (PubChem CID 139792938) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is 2-[4-(1,4-dioxopent-1-en-2-yloxy)butoxy]pent-1-ene-1,4-dione.
| Compound Name | 2-[4-(1,4-dioxopent-1-en-2-yloxy)butoxy]pent-1-ene-1,4-dione |
|---|---|
| PubChem CID | 139792938 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-[4-(1,4-dioxopent-1-en-2-yloxy)butoxy]pent-1-ene-1,4-dione |
| SMILES | CC(=O)CC(=C=O)OCCCCOC(=C=O)CC(C)=O |
| InChI | InChI=1S/C14H18O6/c1-11(17)7-13(9-15)19-5-3-4-6-20-14(10-16)8-12(2)18/h3-8H2,1-2H3 |
| InChIKey | ADZQXLDKULJMRU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|