C28H38Cl2N4O4 — CID 139793566
N-[3-[4-[2-[(3,4-dimethoxyphenyl)methoxy]phenyl]piperazin-1-yl]propyl]-1-methylpyrrole-2-carboxamide;dihydrochloride (PubChem CID 139793566) has the molecular formula C28H38Cl2N4O4 and a molecular weight of 565.54 g/mol. Its IUPAC name is N-[3-[4-[2-[(3,4-dimethoxyphenyl)methoxy]phenyl]piperazin-1-yl]propyl]-1-methylpyrrole-2-carboxamide;dihydrochloride.
| Compound Name | N-[3-[4-[2-[(3,4-dimethoxyphenyl)methoxy]phenyl]piperazin-1-yl]propyl]-1-methylpyrrole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 139793566 |
| Molecular Formula | C28H38Cl2N4O4 |
| Molecular Weight | 565.54 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | N-[3-[4-[2-[(3,4-dimethoxyphenyl)methoxy]phenyl]piperazin-1-yl]propyl]-1-methylpyrrole-2-carboxamide;dihydrochloride |
| SMILES | COc1ccc(COc2ccccc2N2CCN(CCCNC(=O)c3cccn3C)CC2)cc1OC.Cl.Cl |
| InChI | InChI=1S/C28H36N4O4.2ClH/c1-30-14-6-9-24(30)28(33)29-13-7-15-31-16-18-32(19-17-31)23-8-4-5-10-25(23)36-21-22-11-12-26(34-2)27(20-22)35-3;;/h4-6,8-12,14,20H,7,13,15-19,21H2,1-3H3,(H,29,33);2*1H |
| InChIKey | COFBTGGIVLPWQK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 68.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|