C24H40O — CID 139798941
6-(2,3-dibutylphenyl)dec-5-en-5-ol (PubChem CID 139798941) has the molecular formula C24H40O and a molecular weight of 344.58 g/mol. Its IUPAC name is 6-(2,3-dibutylphenyl)dec-5-en-5-ol.
| Compound Name | 6-(2,3-dibutylphenyl)dec-5-en-5-ol |
|---|---|
| PubChem CID | 139798941 |
| Molecular Formula | C24H40O |
| Molecular Weight | 344.58 g/mol |
| Exact Mass | 344.31 |
| IUPAC Name | 6-(2,3-dibutylphenyl)dec-5-en-5-ol |
| SMILES | CCCCC(O)=C(CCCC)c1cccc(CCCC)c1CCCC |
| InChI | InChI=1S/C24H40O/c1-5-9-14-20-15-13-18-22(21(20)16-10-6-2)23(17-11-7-3)24(25)19-12-8-4/h13,15,18,25H,5-12,14,16-17,19H2,1-4H3 |
| InChIKey | JBXNDZUWHCBWIV-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.58 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|