C21H30O4S — CID 139802300
methyl (Z)-7-[3-hydroxy-4-[methoxy(phenylsulfanyl)methyl]cyclopentyl]hept-6-enoate (PubChem CID 139802300) has the molecular formula C21H30O4S and a molecular weight of 378.53 g/mol. Its IUPAC name is methyl (Z)-7-[3-hydroxy-4-[methoxy(phenylsulfanyl)methyl]cyclopentyl]hept-6-enoate.
| Compound Name | methyl (Z)-7-[3-hydroxy-4-[methoxy(phenylsulfanyl)methyl]cyclopentyl]hept-6-enoate |
|---|---|
| PubChem CID | 139802300 |
| Molecular Formula | C21H30O4S |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | methyl (Z)-7-[3-hydroxy-4-[methoxy(phenylsulfanyl)methyl]cyclopentyl]hept-6-enoate |
| SMILES | COC(=O)CCCC/C=C\C1CC(O)C(C(OC)Sc2ccccc2)C1 |
| InChI | InChI=1S/C21H30O4S/c1-24-20(23)13-9-4-3-6-10-16-14-18(19(22)15-16)21(25-2)26-17-11-7-5-8-12-17/h5-8,10-12,16,18-19,21-22H,3-4,9,13-15H2,1-2H3/b10-6- |
| InChIKey | HETMPFNEQKRFDY-POHAHGRESA-N |
| XLogP | 4.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|