C14H18O6 — CID 139807141
4,5,6,7-tetramethoxy-2,2-dimethyl-1-benzofuran-3-one (PubChem CID 139807141) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is 4,5,6,7-tetramethoxy-2,2-dimethyl-1-benzofuran-3-one.
| Compound Name | 4,5,6,7-tetramethoxy-2,2-dimethyl-1-benzofuran-3-one |
|---|---|
| PubChem CID | 139807141 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 4,5,6,7-tetramethoxy-2,2-dimethyl-1-benzofuran-3-one |
| SMILES | COc1c(OC)c(OC)c2c(c1OC)OC(C)(C)C2=O |
| InChI | InChI=1S/C14H18O6/c1-14(2)13(15)7-8(16-3)10(17-4)12(19-6)11(18-5)9(7)20-14/h1-6H3 |
| InChIKey | IXNWTTVPOMPQKP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |