C25H32N2O3 — CID 66760383
5-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2,2,4,6,7-pentamethyl-1-benzofuran-3-one (PubChem CID 66760383) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is 5-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2,2,4,6,7-pentamethyl-1-benzofuran-3-one.
| Compound Name | 5-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2,2,4,6,7-pentamethyl-1-benzofuran-3-one |
|---|---|
| PubChem CID | 66760383 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 5-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2,2,4,6,7-pentamethyl-1-benzofuran-3-one |
| SMILES | COc1ccc(N2CCCN(c3c(C)c(C)c4c(c3C)C(=O)C(C)(C)O4)CC2)cc1 |
| InChI | InChI=1S/C25H32N2O3/c1-16-17(2)23-21(24(28)25(4,5)30-23)18(3)22(16)27-13-7-12-26(14-15-27)19-8-10-20(29-6)11-9-19/h8-11H,7,12-15H2,1-6H3 |
| InChIKey | QCPSLPKNVHTANA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|