C25H32N2O4 — CID 91565409
[5-[4-(4-methoxyphenyl)piperazin-1-yl]-2,4,6,7-tetramethyl-3H-1-benzofuran-2-yl] acetate (PubChem CID 91565409) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is [5-[4-(4-methoxyphenyl)piperazin-1-yl]-2,4,6,7-tetramethyl-3H-1-benzofuran-2-yl] acetate.
| Compound Name | [5-[4-(4-methoxyphenyl)piperazin-1-yl]-2,4,6,7-tetramethyl-3H-1-benzofuran-2-yl] acetate |
|---|---|
| PubChem CID | 91565409 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | [5-[4-(4-methoxyphenyl)piperazin-1-yl]-2,4,6,7-tetramethyl-3H-1-benzofuran-2-yl] acetate |
| SMILES | COc1ccc(N2CCN(c3c(C)c(C)c4c(c3C)CC(C)(OC(C)=O)O4)CC2)cc1 |
| InChI | InChI=1S/C25H32N2O4/c1-16-17(2)24-22(15-25(5,31-24)30-19(4)28)18(3)23(16)27-13-11-26(12-14-27)20-7-9-21(29-6)10-8-20/h7-10H,11-15H2,1-6H3 |
| InChIKey | VMKIGJBCLGQUCG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|