C24H33N3O2 — CID 22111107
2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine (PubChem CID 22111107) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine.
| Compound Name | 2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 22111107 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine |
| SMILES | COc1ccc(N2CCN(CC3(C)Cc4c(C)c(N)c(C)c(C)c4O3)CC2)cc1 |
| InChI | InChI=1S/C24H33N3O2/c1-16-17(2)23-21(18(3)22(16)25)14-24(4,29-23)15-26-10-12-27(13-11-26)19-6-8-20(28-5)9-7-19/h6-9H,10-15,25H2,1-5H3 |
| InChIKey | PGIZWULJIJCWPM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|