C32H40N2O3 — CID 10163989
1-[3-methoxy-2,2,4,6,7-pentamethyl-3-(4-methylphenyl)-1-benzofuran-5-yl]-4-(4-methoxyphenyl)piperazine (PubChem CID 10163989) has the molecular formula C32H40N2O3 and a molecular weight of 500.68 g/mol. Its IUPAC name is 1-[3-methoxy-2,2,4,6,7-pentamethyl-3-(4-methylphenyl)-1-benzofuran-5-yl]-4-(4-methoxyphenyl)piperazine.
| Compound Name | 1-[3-methoxy-2,2,4,6,7-pentamethyl-3-(4-methylphenyl)-1-benzofuran-5-yl]-4-(4-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 10163989 |
| Molecular Formula | C32H40N2O3 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | 1-[3-methoxy-2,2,4,6,7-pentamethyl-3-(4-methylphenyl)-1-benzofuran-5-yl]-4-(4-methoxyphenyl)piperazine |
| SMILES | COc1ccc(N2CCN(c3c(C)c(C)c4c(c3C)C(OC)(c3ccc(C)cc3)C(C)(C)O4)CC2)cc1 |
| InChI | InChI=1S/C32H40N2O3/c1-21-9-11-25(12-10-21)32(36-8)28-24(4)29(22(2)23(3)30(28)37-31(32,5)6)34-19-17-33(18-20-34)26-13-15-27(35-7)16-14-26/h9-16H,17-20H2,1-8H3 |
| InChIKey | LWVUSSXJMDEBJM-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|