C28H39N3O2 — CID 59485089
1-(4-methoxyphenyl)-4-[2,4,6,7-tetramethyl-2-(pyrrolidin-1-ylmethyl)-3H-1-benzofuran-5-yl]piperazine (PubChem CID 59485089) has the molecular formula C28H39N3O2 and a molecular weight of 449.64 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-[2,4,6,7-tetramethyl-2-(pyrrolidin-1-ylmethyl)-3H-1-benzofuran-5-yl]piperazine.
| Compound Name | 1-(4-methoxyphenyl)-4-[2,4,6,7-tetramethyl-2-(pyrrolidin-1-ylmethyl)-3H-1-benzofuran-5-yl]piperazine |
|---|---|
| PubChem CID | 59485089 |
| Molecular Formula | C28H39N3O2 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-[2,4,6,7-tetramethyl-2-(pyrrolidin-1-ylmethyl)-3H-1-benzofuran-5-yl]piperazine |
| SMILES | COc1ccc(N2CCN(c3c(C)c(C)c4c(c3C)CC(C)(CN3CCCC3)O4)CC2)cc1 |
| InChI | InChI=1S/C28H39N3O2/c1-20-21(2)27-25(18-28(4,33-27)19-29-12-6-7-13-29)22(3)26(20)31-16-14-30(15-17-31)23-8-10-24(32-5)11-9-23/h8-11H,6-7,12-19H2,1-5H3 |
| InChIKey | VLTOUMDFYRYMKJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|