C24H30N2O4 — CID 66760929
7-methoxy-5-[4-(4-methoxyphenyl)piperazin-1-yl]-2,2,4,6-tetramethyl-1-benzofuran-3-one (PubChem CID 66760929) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 7-methoxy-5-[4-(4-methoxyphenyl)piperazin-1-yl]-2,2,4,6-tetramethyl-1-benzofuran-3-one.
| Compound Name | 7-methoxy-5-[4-(4-methoxyphenyl)piperazin-1-yl]-2,2,4,6-tetramethyl-1-benzofuran-3-one |
|---|---|
| PubChem CID | 66760929 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 7-methoxy-5-[4-(4-methoxyphenyl)piperazin-1-yl]-2,2,4,6-tetramethyl-1-benzofuran-3-one |
| SMILES | COc1ccc(N2CCN(c3c(C)c(OC)c4c(c3C)C(=O)C(C)(C)O4)CC2)cc1 |
| InChI | InChI=1S/C24H30N2O4/c1-15-19-22(30-24(3,4)23(19)27)21(29-6)16(2)20(15)26-13-11-25(12-14-26)17-7-9-18(28-5)10-8-17/h7-10H,11-14H2,1-6H3 |
| InChIKey | JKXRPPSERVNZDI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|