C34H38N2O3 — CID 10142866
5-[4-(4-methoxyphenyl)piperazin-1-yl]-2,2,4,6,7-pentamethyl-3-naphthalen-1-yl-1-benzofuran-3-ol (PubChem CID 10142866) has the molecular formula C34H38N2O3 and a molecular weight of 522.69 g/mol. Its IUPAC name is 5-[4-(4-methoxyphenyl)piperazin-1-yl]-2,2,4,6,7-pentamethyl-3-naphthalen-1-yl-1-benzofuran-3-ol.
| Compound Name | 5-[4-(4-methoxyphenyl)piperazin-1-yl]-2,2,4,6,7-pentamethyl-3-naphthalen-1-yl-1-benzofuran-3-ol |
|---|---|
| PubChem CID | 10142866 |
| Molecular Formula | C34H38N2O3 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | 5-[4-(4-methoxyphenyl)piperazin-1-yl]-2,2,4,6,7-pentamethyl-3-naphthalen-1-yl-1-benzofuran-3-ol |
| SMILES | COc1ccc(N2CCN(c3c(C)c(C)c4c(c3C)C(O)(c3cccc5ccccc35)C(C)(C)O4)CC2)cc1 |
| InChI | InChI=1S/C34H38N2O3/c1-22-23(2)32-30(34(37,33(4,5)39-32)29-13-9-11-25-10-7-8-12-28(25)29)24(3)31(22)36-20-18-35(19-21-36)26-14-16-27(38-6)17-15-26/h7-17,37H,18-21H2,1-6H3 |
| InChIKey | XTAHGMLIZXYKOI-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|