C22H26O9 — CID 139980177
2-(3,4-dimethoxyphenyl)-2,5,6,7,8-pentamethoxy-3H-chromen-4-one (PubChem CID 139980177) has the molecular formula C22H26O9 and a molecular weight of 434.44 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-2,5,6,7,8-pentamethoxy-3H-chromen-4-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-2,5,6,7,8-pentamethoxy-3H-chromen-4-one |
|---|---|
| PubChem CID | 139980177 |
| Molecular Formula | C22H26O9 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-2,5,6,7,8-pentamethoxy-3H-chromen-4-one |
| SMILES | COc1ccc(C2(OC)CC(=O)c3c(OC)c(OC)c(OC)c(OC)c3O2)cc1OC |
| InChI | InChI=1S/C22H26O9/c1-24-14-9-8-12(10-15(14)25-2)22(30-7)11-13(23)16-17(26-3)19(27-4)21(29-6)20(28-5)18(16)31-22/h8-10H,11H2,1-7H3 |
| InChIKey | YZXOGGWXCKMOGT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |