C9HCl4NO3 — CID 139810190
4,6,7-trichloro-1,3-dioxoisoindole-5-carbonyl chloride (PubChem CID 139810190) has the molecular formula C9HCl4NO3 and a molecular weight of 312.92 g/mol. Its IUPAC name is 4,6,7-trichloro-1,3-dioxoisoindole-5-carbonyl chloride.
| Compound Name | 4,6,7-trichloro-1,3-dioxoisoindole-5-carbonyl chloride |
|---|---|
| PubChem CID | 139810190 |
| Molecular Formula | C9HCl4NO3 |
| Molecular Weight | 312.92 g/mol |
| Exact Mass | 310.87 |
| IUPAC Name | 4,6,7-trichloro-1,3-dioxoisoindole-5-carbonyl chloride |
| SMILES | O=C(Cl)c1c(Cl)c(Cl)c2c(c1Cl)C(=O)NC2=O |
| InChI | InChI=1S/C9HCl4NO3/c10-4-1-2(9(17)14-8(1)16)5(11)6(12)3(4)7(13)15/h(H,14,16,17) |
| InChIKey | AMCVMRYBCAFMHW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.92 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|