C24H10Cl10O6 — CID 19354144
4,6,7-trichloro-1,3-dioxo-2-benzofuran-5-carbonyl chloride;2,3,6-trichloro-4-[2-(2,3,5-trichloro-4-hydroxyphenyl)propan-2-yl]phenol (PubChem CID 19354144) has the molecular formula C24H10Cl10O6 and a molecular weight of 748.87 g/mol. Its IUPAC name is 4,6,7-trichloro-1,3-dioxo-2-benzofuran-5-carbonyl chloride;2,3,6-trichloro-4-[2-(2,3,5-trichloro-4-hydroxyphenyl)propan-2-yl]phenol.
| Compound Name | 4,6,7-trichloro-1,3-dioxo-2-benzofuran-5-carbonyl chloride;2,3,6-trichloro-4-[2-(2,3,5-trichloro-4-hydroxyphenyl)propan-2-yl]phenol |
|---|---|
| PubChem CID | 19354144 |
| Molecular Formula | C24H10Cl10O6 |
| Molecular Weight | 748.87 g/mol |
| Exact Mass | 743.74 |
| IUPAC Name | 4,6,7-trichloro-1,3-dioxo-2-benzofuran-5-carbonyl chloride;2,3,6-trichloro-4-[2-(2,3,5-trichloro-4-hydroxyphenyl)propan-2-yl]phenol |
| SMILES | CC(C)(c1cc(Cl)c(O)c(Cl)c1Cl)c1cc(Cl)c(O)c(Cl)c1Cl.O=C(Cl)c1c(Cl)c(Cl)c2c(c1Cl)C(=O)OC2=O |
| InChI | InChI=1S/C15H10Cl6O2.C9Cl4O4/c1-15(2,5-3-7(16)13(22)11(20)9(5)18)6-4-8(17)14(23)12(21)10(6)19;10-4-1-2(9(16)17-8(1)15)5(11)6(12)3(4)7(13)14/h3-4,22-23H,1-2H3; |
| InChIKey | ADJQPZYVEGACGB-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.87 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|