C22H21NO7 — CID 139811728
1-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-3,4-dihydro-2H-quinoline-2,3-dicarboxylic acid (PubChem CID 139811728) has the molecular formula C22H21NO7 and a molecular weight of 411.41 g/mol. Its IUPAC name is 1-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-3,4-dihydro-2H-quinoline-2,3-dicarboxylic acid.
| Compound Name | 1-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-3,4-dihydro-2H-quinoline-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 139811728 |
| Molecular Formula | C22H21NO7 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 1-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-3,4-dihydro-2H-quinoline-2,3-dicarboxylic acid |
| SMILES | COc1ccc(/C=C/C(=O)N2c3ccccc3CC(C(=O)O)C2C(=O)O)cc1OC |
| InChI | InChI=1S/C22H21NO7/c1-29-17-9-7-13(11-18(17)30-2)8-10-19(24)23-16-6-4-3-5-14(16)12-15(21(25)26)20(23)22(27)28/h3-11,15,20H,12H2,1-2H3,(H,25,26)(H,27,28)/b10-8+ |
| InChIKey | CAHFQOYVCBVPQO-CSKARUKUSA-N |
| XLogP | 2.46 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|