C14H19NO6 — CID 139812760
[2,2-bis(hydroxymethyl)-3-prop-2-enoyloxypropyl] 4-cyano-2-methylidenebutanoate (PubChem CID 139812760) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is [2,2-bis(hydroxymethyl)-3-prop-2-enoyloxypropyl] 4-cyano-2-methylidenebutanoate.
| Compound Name | [2,2-bis(hydroxymethyl)-3-prop-2-enoyloxypropyl] 4-cyano-2-methylidenebutanoate |
|---|---|
| PubChem CID | 139812760 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | [2,2-bis(hydroxymethyl)-3-prop-2-enoyloxypropyl] 4-cyano-2-methylidenebutanoate |
| SMILES | C=CC(=O)OCC(CO)(CO)COC(=O)C(=C)CCC#N |
| InChI | InChI=1S/C14H19NO6/c1-3-12(18)20-9-14(7-16,8-17)10-21-13(19)11(2)5-4-6-15/h3,16-17H,1-2,4-5,7-10H2 |
| InChIKey | CJIDNYVFCLILER-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 116.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|