About 1-nitro-2-phenylethene-1,2-diol
1-nitro-2-phenylethene-1,2-diol (PubChem CID 139815015) has the molecular formula C8H7NO4
and a molecular weight of 181.15 g/mol. Its IUPAC name is 1-nitro-2-phenylethene-1,2-diol.
Molecular Properties
| Compound Name | 1-nitro-2-phenylethene-1,2-diol |
| PubChem CID | 139815015 |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 1-nitro-2-phenylethene-1,2-diol |
| SMILES | O=[N+]([O-])C(O)=C(O)c1ccccc1 |
| InChI | InChI=1S/C8H7NO4/c10-7(8(11)9(12)13)6-4-2-1-3-5-6/h1-5,10-11H |
| InChIKey | VMVWGPCQFWHBNF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitro-2-phenylethene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitro-2-phenylethene-1,2-diol?
The IUPAC name of 1-nitro-2-phenylethene-1,2-diol (CID 139815015) is 1-nitro-2-phenylethene-1,2-diol.
What is the SMILES notation for 1-nitro-2-phenylethene-1,2-diol?
The canonical SMILES for 1-nitro-2-phenylethene-1,2-diol is O=[N+]([O-])C(O)=C(O)c1ccccc1.
What is the InChIKey of 1-nitro-2-phenylethene-1,2-diol?
The InChIKey is VMVWGPCQFWHBNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO4/c10-7(8(11)9(12)13)6-4-2-1-3-5-6/h1-5,10-11H.
What are the key properties of 1-nitro-2-phenylethene-1,2-diol?
1-nitro-2-phenylethene-1,2-diol has a molecular weight of 181.15 g/mol, XLogP of 1.71, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitro-2-phenylethene-1,2-diol is sourced from PubChem (CID 139815015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).