C14H8O4S — CID 139815555
naphtho[1,2-g][1,3,2]benzodioxathiole 2,2-dioxide (PubChem CID 139815555) has the molecular formula C14H8O4S and a molecular weight of 272.28 g/mol. Its IUPAC name is naphtho[1,2-g][1,3,2]benzodioxathiole 2,2-dioxide.
| Compound Name | naphtho[1,2-g][1,3,2]benzodioxathiole 2,2-dioxide |
|---|---|
| PubChem CID | 139815555 |
| Molecular Formula | C14H8O4S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | naphtho[1,2-g][1,3,2]benzodioxathiole 2,2-dioxide |
| SMILES | O=S1(=O)Oc2ccc3c(ccc4ccccc43)c2O1 |
| InChI | InChI=1S/C14H8O4S/c15-19(16)17-13-8-7-11-10-4-2-1-3-9(10)5-6-12(11)14(13)18-19/h1-8H |
| InChIKey | KPBLKQGPGSLPBT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|