C7ClF15 — CID 139815778
2-chloro-1,1,1,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane (PubChem CID 139815778) has the molecular formula C7ClF15 and a molecular weight of 404.50 g/mol. Its IUPAC name is 2-chloro-1,1,1,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane.
| Compound Name | 2-chloro-1,1,1,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane |
|---|---|
| PubChem CID | 139815778 |
| Molecular Formula | C7ClF15 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 403.94 |
| IUPAC Name | 2-chloro-1,1,1,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(Cl)C(F)(F)F |
| InChI | InChI=1S/C7ClF15/c8-1(9,6(18,19)20)2(10,11)3(12,13)4(14,15)5(16,17)7(21,22)23 |
| InChIKey | KUWBCLIIBUINBD-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|