C18H20O4 — CID 139826647
4-[3-(2-hydroxy-4-prop-1-enoxyphenyl)propyl]benzene-1,3-diol (PubChem CID 139826647) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is 4-[3-(2-hydroxy-4-prop-1-enoxyphenyl)propyl]benzene-1,3-diol.
| Compound Name | 4-[3-(2-hydroxy-4-prop-1-enoxyphenyl)propyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 139826647 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 4-[3-(2-hydroxy-4-prop-1-enoxyphenyl)propyl]benzene-1,3-diol |
| SMILES | CC=COc1ccc(CCCc2ccc(O)cc2O)c(O)c1 |
| InChI | InChI=1S/C18H20O4/c1-2-10-22-16-9-7-14(18(21)12-16)5-3-4-13-6-8-15(19)11-17(13)20/h2,6-12,19-21H,3-5H2,1H3 |
| InChIKey | UCEYOUCXPQIAML-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|