C12H19O4P — CID 142472521
butoxy-[2-(2,4-dihydroxyphenyl)ethyl]phosphinous acid (PubChem CID 142472521) has the molecular formula C12H19O4P and a molecular weight of 258.25 g/mol. Its IUPAC name is butoxy-[2-(2,4-dihydroxyphenyl)ethyl]phosphinous acid.
| Compound Name | butoxy-[2-(2,4-dihydroxyphenyl)ethyl]phosphinous acid |
|---|---|
| PubChem CID | 142472521 |
| Molecular Formula | C12H19O4P |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | butoxy-[2-(2,4-dihydroxyphenyl)ethyl]phosphinous acid |
| SMILES | CCCCOP(O)CCc1ccc(O)cc1O |
| InChI | InChI=1S/C12H19O4P/c1-2-3-7-16-17(15)8-6-10-4-5-11(13)9-12(10)14/h4-5,9,13-15H,2-3,6-8H2,1H3 |
| InChIKey | AFJSZPIIESPHNJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|