butoxy-[2-(2,4-dihydroxyphenyl)ethyl]phosphinous acid

C12H19O4P — CID 142472521

IUPACbutoxy-[2-(2,4-dihydroxyphenyl)ethyl]phosphinous acid
SMILESCCCCOP(O)CCc1ccc(O)cc1O
InChIInChI=1S/C12H19O4P/c1-2-3-7-16-17(15)8-6-10-4-5-11(13)9-12(10)14/h4-5,9,13-15H,2-3,6-8H2,1H3
InChIKeyAFJSZPIIESPHNJ-UHFFFAOYSA-N
MW258.25 g/mol
LogP2.76
Rot. Bonds7

About butoxy-[2-(2,4-dihydroxyphenyl)ethyl]phosphinous acid

butoxy-[2-(2,4-dihydroxyphenyl)ethyl]phosphinous acid (PubChem CID 142472521) has the molecular formula C12H19O4P and a molecular weight of 258.25 g/mol. Its IUPAC name is butoxy-[2-(2,4-dihydroxyphenyl)ethyl]phosphinous acid.

Molecular Properties

Compound Namebutoxy-[2-(2,4-dihydroxyphenyl)ethyl]phosphinous acid
PubChem CID142472521
Molecular FormulaC12H19O4P
Molecular Weight258.25 g/mol
Exact Mass258.10
IUPAC Namebutoxy-[2-(2,4-dihydroxyphenyl)ethyl]phosphinous acid
SMILESCCCCOP(O)CCc1ccc(O)cc1O
InChIInChI=1S/C12H19O4P/c1-2-3-7-16-17(15)8-6-10-4-5-11(13)9-12(10)14/h4-5,9,13-15H,2-3,6-8H2,1H3
InChIKeyAFJSZPIIESPHNJ-UHFFFAOYSA-N
XLogP2.76
TPSA69.92 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.25
LogP ≤ 52.76
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze butoxy-[2-(2,4-dihydroxyphenyl)ethyl]phosphinous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butoxy-[2-(2,4-dihydroxyphenyl)ethyl]phosphinous acid?
The IUPAC name of butoxy-[2-(2,4-dihydroxyphenyl)ethyl]phosphinous acid (CID 142472521) is butoxy-[2-(2,4-dihydroxyphenyl)ethyl]phosphinous acid.
What is the SMILES notation for butoxy-[2-(2,4-dihydroxyphenyl)ethyl]phosphinous acid?
The canonical SMILES for butoxy-[2-(2,4-dihydroxyphenyl)ethyl]phosphinous acid is CCCCOP(O)CCc1ccc(O)cc1O.
What is the InChIKey of butoxy-[2-(2,4-dihydroxyphenyl)ethyl]phosphinous acid?
The InChIKey is AFJSZPIIESPHNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19O4P/c1-2-3-7-16-17(15)8-6-10-4-5-11(13)9-12(10)14/h4-5,9,13-15H,2-3,6-8H2,1H3.
What are the key properties of butoxy-[2-(2,4-dihydroxyphenyl)ethyl]phosphinous acid?
butoxy-[2-(2,4-dihydroxyphenyl)ethyl]phosphinous acid has a molecular weight of 258.25 g/mol, XLogP of 2.76, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butoxy-[2-(2,4-dihydroxyphenyl)ethyl]phosphinous acid is sourced from PubChem (CID 142472521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).