C13H15NO4 — CID 139831362
8-ethoxy-5-methoxy-4-nitro-1,2-dihydronaphthalene (PubChem CID 139831362) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 8-ethoxy-5-methoxy-4-nitro-1,2-dihydronaphthalene.
| Compound Name | 8-ethoxy-5-methoxy-4-nitro-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 139831362 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 8-ethoxy-5-methoxy-4-nitro-1,2-dihydronaphthalene |
| SMILES | CCOc1ccc(OC)c2c1CCC=C2[N+](=O)[O-] |
| InChI | InChI=1S/C13H15NO4/c1-3-18-11-7-8-12(17-2)13-9(11)5-4-6-10(13)14(15)16/h6-8H,3-5H2,1-2H3 |
| InChIKey | XJWQDISTCXYFQX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|