C28H29FN4O2 — CID 139886389
2-[1-[(2-fluorophenyl)methyl]imidazol-2-yl]-N-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]acetamide (PubChem CID 139886389) has the molecular formula C28H29FN4O2 and a molecular weight of 472.56 g/mol. Its IUPAC name is 2-[1-[(2-fluorophenyl)methyl]imidazol-2-yl]-N-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]acetamide.
| Compound Name | 2-[1-[(2-fluorophenyl)methyl]imidazol-2-yl]-N-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 139886389 |
| Molecular Formula | C28H29FN4O2 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 2-[1-[(2-fluorophenyl)methyl]imidazol-2-yl]-N-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]acetamide |
| SMILES | O=C(Cc1nccn1Cc1ccccc1F)Nc1ccc(CCNC[C@H](O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H29FN4O2/c29-25-9-5-4-8-23(25)20-33-17-16-31-27(33)18-28(35)32-24-12-10-21(11-13-24)14-15-30-19-26(34)22-6-2-1-3-7-22/h1-13,16-17,26,30,34H,14-15,18-20H2,(H,32,35)/t26-/m0/s1 |
| InChIKey | BJSZNGVXXFZYRK-SANMLTNESA-N |
| XLogP | 4.12 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|