C28H29Cl2F3N4O2 — CID 18319850
N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]-2-[1-[(3,4,5-trifluorophenyl)methyl]imidazol-2-yl]acetamide;dihydrochloride (PubChem CID 18319850) has the molecular formula C28H29Cl2F3N4O2 and a molecular weight of 581.47 g/mol. Its IUPAC name is N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]-2-[1-[(3,4,5-trifluorophenyl)methyl]imidazol-2-yl]acetamide;dihydrochloride.
| Compound Name | N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]-2-[1-[(3,4,5-trifluorophenyl)methyl]imidazol-2-yl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 18319850 |
| Molecular Formula | C28H29Cl2F3N4O2 |
| Molecular Weight | 581.47 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]-2-[1-[(3,4,5-trifluorophenyl)methyl]imidazol-2-yl]acetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Cc1nccn1Cc1cc(F)c(F)c(F)c1)Nc1ccc(CCNCC(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H27F3N4O2.2ClH/c29-23-14-20(15-24(30)28(23)31)18-35-13-12-33-26(35)16-27(37)34-22-8-6-19(7-9-22)10-11-32-17-25(36)21-4-2-1-3-5-21;;/h1-9,12-15,25,32,36H,10-11,16-18H2,(H,34,37);2*1H |
| InChIKey | PSESTVQZZFKAKF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|