C27H27ClN4O3S — CID 139886579
1-[2-(5-chloro-2-oxo-1,3-benzothiazol-3-yl)acetyl]-N-[2-(naphthalen-1-ylamino)ethyl]piperidine-4-carboxamide (PubChem CID 139886579) has the molecular formula C27H27ClN4O3S and a molecular weight of 523.06 g/mol. Its IUPAC name is 1-[2-(5-chloro-2-oxo-1,3-benzothiazol-3-yl)acetyl]-N-[2-(naphthalen-1-ylamino)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(5-chloro-2-oxo-1,3-benzothiazol-3-yl)acetyl]-N-[2-(naphthalen-1-ylamino)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 139886579 |
| Molecular Formula | C27H27ClN4O3S |
| Molecular Weight | 523.06 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | 1-[2-(5-chloro-2-oxo-1,3-benzothiazol-3-yl)acetyl]-N-[2-(naphthalen-1-ylamino)ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCNc1cccc2ccccc12)C1CCN(C(=O)Cn2c(=O)sc3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C27H27ClN4O3S/c28-20-8-9-24-23(16-20)32(27(35)36-24)17-25(33)31-14-10-19(11-15-31)26(34)30-13-12-29-22-7-3-5-18-4-1-2-6-21(18)22/h1-9,16,19,29H,10-15,17H2,(H,30,34) |
| InChIKey | JHGNYNJRIYRADG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.06 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|