C10H11ClN2O — CID 139889338
2-(5-chloro-2-pyridinyl)-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 139889338) has the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. Its IUPAC name is 2-(5-chloro-2-pyridinyl)-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-(5-chloro-2-pyridinyl)-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 139889338 |
| Molecular Formula | C10H11ClN2O |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 2-(5-chloro-2-pyridinyl)-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC(c2ccc(Cl)cn2)=N1 |
| InChI | InChI=1S/C10H11ClN2O/c1-10(2)6-14-9(13-10)8-4-3-7(11)5-12-8/h3-5H,6H2,1-2H3 |
| InChIKey | OXSTVAWVYVCVBC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |