C19H15Cl3F3NO2 — CID 139893279
1-[2-chloro-4-(3,3-dichloroprop-2-enoxy)phenyl]-N-[1-[3-(trifluoromethyl)phenyl]ethoxy]methanimine (PubChem CID 139893279) has the molecular formula C19H15Cl3F3NO2 and a molecular weight of 452.69 g/mol. Its IUPAC name is 1-[2-chloro-4-(3,3-dichloroprop-2-enoxy)phenyl]-N-[1-[3-(trifluoromethyl)phenyl]ethoxy]methanimine.
| Compound Name | 1-[2-chloro-4-(3,3-dichloroprop-2-enoxy)phenyl]-N-[1-[3-(trifluoromethyl)phenyl]ethoxy]methanimine |
|---|---|
| PubChem CID | 139893279 |
| Molecular Formula | C19H15Cl3F3NO2 |
| Molecular Weight | 452.69 g/mol |
| Exact Mass | 451.01 |
| IUPAC Name | 1-[2-chloro-4-(3,3-dichloroprop-2-enoxy)phenyl]-N-[1-[3-(trifluoromethyl)phenyl]ethoxy]methanimine |
| SMILES | CC(ON=Cc1ccc(OCC=C(Cl)Cl)cc1Cl)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H15Cl3F3NO2/c1-12(13-3-2-4-15(9-13)19(23,24)25)28-26-11-14-5-6-16(10-17(14)20)27-8-7-18(21)22/h2-7,9-12H,8H2,1H3 |
| InChIKey | OETBOJOGBYWCFX-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.69 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|