C11H21N5S — CID 139896455
2,6-bis(butylamino)-1H-1,3,5-triazine-4-thione (PubChem CID 139896455) has the molecular formula C11H21N5S and a molecular weight of 255.39 g/mol. Its IUPAC name is 2,6-bis(butylamino)-1H-1,3,5-triazine-4-thione.
| Compound Name | 2,6-bis(butylamino)-1H-1,3,5-triazine-4-thione |
|---|---|
| PubChem CID | 139896455 |
| Molecular Formula | C11H21N5S |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 2,6-bis(butylamino)-1H-1,3,5-triazine-4-thione |
| SMILES | CCCCNc1nc(=S)nc(NCCCC)[nH]1 |
| InChI | InChI=1S/C11H21N5S/c1-3-5-7-12-9-14-10(13-8-6-4-2)16-11(17)15-9/h3-8H2,1-2H3,(H3,12,13,14,15,16,17) |
| InChIKey | WDBAEJABGXRJCU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|