C11H19LiN4S2 — CID 175298844
lithium 6-(octylamino)-1H-1,3,5-triazine-2,4-dithione (PubChem CID 175298844) has the molecular formula C11H19LiN4S2 and a molecular weight of 278.38 g/mol. Its IUPAC name is lithium 6-(octylamino)-1H-1,3,5-triazine-2,4-dithione.
| Compound Name | lithium 6-(octylamino)-1H-1,3,5-triazine-2,4-dithione |
|---|---|
| PubChem CID | 175298844 |
| Molecular Formula | C11H19LiN4S2 |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | lithium 6-(octylamino)-1H-1,3,5-triazine-2,4-dithione |
| SMILES | CC[CH-]CCCCCNc1nc(=S)[nH]c(=S)[nH]1.[Li+] |
| InChI | InChI=1S/C11H19N4S2.Li/c1-2-3-4-5-6-7-8-12-9-13-10(16)15-11(17)14-9;/h3H,2,4-8H2,1H3,(H3,12,13,14,15,16,17);/q-1;+1 |
| InChIKey | UGGNZQILSOSVJR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 56.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|