C5H7N3OS2 — CID 15681572
6-ethoxy-1H-1,3,5-triazine-2,4-dithione (PubChem CID 15681572) has the molecular formula C5H7N3OS2 and a molecular weight of 189.26 g/mol. Its IUPAC name is 6-ethoxy-1H-1,3,5-triazine-2,4-dithione.
| Compound Name | 6-ethoxy-1H-1,3,5-triazine-2,4-dithione |
|---|---|
| PubChem CID | 15681572 |
| Molecular Formula | C5H7N3OS2 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.00 |
| IUPAC Name | 6-ethoxy-1H-1,3,5-triazine-2,4-dithione |
| SMILES | CCOc1nc(=S)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C5H7N3OS2/c1-2-9-3-6-4(10)8-5(11)7-3/h2H2,1H3,(H2,6,7,8,10,11) |
| InChIKey | WLCLTZMBTZGWRA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 53.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|