C11H20N4S2 — CID 3035346
6-(dibutylamino)-1H-1,3,5-triazine-2,4-dithione (PubChem CID 3035346) has the molecular formula C11H20N4S2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 6-(dibutylamino)-1H-1,3,5-triazine-2,4-dithione.
| Compound Name | 6-(dibutylamino)-1H-1,3,5-triazine-2,4-dithione |
|---|---|
| PubChem CID | 3035346 |
| Molecular Formula | C11H20N4S2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 6-(dibutylamino)-1H-1,3,5-triazine-2,4-dithione |
| SMILES | CCCCN(CCCC)c1nc(=S)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C11H20N4S2/c1-3-5-7-15(8-6-4-2)9-12-10(16)14-11(17)13-9/h3-8H2,1-2H3,(H2,12,13,14,16,17) |
| InChIKey | IXDGHAZCSMVIFX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 47.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|