C11H19N3S3 — CID 3350773
6-octylsulfanyl-1H-1,3,5-triazine-2,4-dithione (PubChem CID 3350773) has the molecular formula C11H19N3S3 and a molecular weight of 289.49 g/mol. Its IUPAC name is 6-octylsulfanyl-1H-1,3,5-triazine-2,4-dithione.
| Compound Name | 6-octylsulfanyl-1H-1,3,5-triazine-2,4-dithione |
|---|---|
| PubChem CID | 3350773 |
| Molecular Formula | C11H19N3S3 |
| Molecular Weight | 289.49 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 6-octylsulfanyl-1H-1,3,5-triazine-2,4-dithione |
| SMILES | CCCCCCCCSc1nc(=S)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C11H19N3S3/c1-2-3-4-5-6-7-8-17-11-13-9(15)12-10(16)14-11/h2-8H2,1H3,(H2,12,13,14,15,16) |
| InChIKey | ZGVGEYQNIWQYDR-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|