C46H88N10S4 — CID 139608353
6-(dioctylamino)-4-[[6-[[2-(dioctylamino)-6-sulfanylidene-1H-1,3,5-triazin-4-yl]sulfanylmethylamino]hexylamino]methylsulfanyl]-1H-1,3,5-triazine-2-thione (PubChem CID 139608353) has the molecular formula C46H88N10S4 and a molecular weight of 909.55 g/mol. Its IUPAC name is 6-(dioctylamino)-4-[[6-[[2-(dioctylamino)-6-sulfanylidene-1H-1,3,5-triazin-4-yl]sulfanylmethylamino]hexylamino]methylsulfanyl]-1H-1,3,5-triazine-2-thione.
| Compound Name | 6-(dioctylamino)-4-[[6-[[2-(dioctylamino)-6-sulfanylidene-1H-1,3,5-triazin-4-yl]sulfanylmethylamino]hexylamino]methylsulfanyl]-1H-1,3,5-triazine-2-thione |
|---|---|
| PubChem CID | 139608353 |
| Molecular Formula | C46H88N10S4 |
| Molecular Weight | 909.55 g/mol |
| Exact Mass | 908.61 |
| IUPAC Name | 6-(dioctylamino)-4-[[6-[[2-(dioctylamino)-6-sulfanylidene-1H-1,3,5-triazin-4-yl]sulfanylmethylamino]hexylamino]methylsulfanyl]-1H-1,3,5-triazine-2-thione |
| SMILES | CCCCCCCCN(CCCCCCCC)c1nc(SCNCCCCCCNCSc2nc(N(CCCCCCCC)CCCCCCCC)[nH]c(=S)n2)nc(=S)[nH]1 |
| InChI | InChI=1S/C46H88N10S4/c1-5-9-13-17-23-29-35-55(36-30-24-18-14-10-6-2)41-49-43(57)53-45(51-41)59-39-47-33-27-21-22-28-34-48-40-60-46-52-42(50-44(58)54-46)56(37-31-25-19-15-11-7-3)38-32-26-20-16-12-8-4/h47-48H,5-40H2,1-4H3,(H,49,51,53,57)(H,50,52,54,58) |
| InChIKey | RHIRDPFWMBHQHF-UHFFFAOYSA-N |
| XLogP | 13.98 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.55 |
| LogP ≤ 5 | 13.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|