C24H22N2O3S — CID 139901346
3-[1-(4-phenylphenoxy)-4-pyridin-3-ylbutan-2-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 139901346) has the molecular formula C24H22N2O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is 3-[1-(4-phenylphenoxy)-4-pyridin-3-ylbutan-2-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[1-(4-phenylphenoxy)-4-pyridin-3-ylbutan-2-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 139901346 |
| Molecular Formula | C24H22N2O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 3-[1-(4-phenylphenoxy)-4-pyridin-3-ylbutan-2-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1CSC(=O)N1C(CCc1cccnc1)COc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22N2O3S/c27-23-17-30-24(28)26(23)21(11-8-18-5-4-14-25-15-18)16-29-22-12-9-20(10-13-22)19-6-2-1-3-7-19/h1-7,9-10,12-15,21H,8,11,16-17H2 |
| InChIKey | QAFPTIUKIUJUPE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|