C22H46O4 — CID 139905465
2,7-bis(tert-butylperoxy)-2,3,3,6,6,7-hexamethyloctane (PubChem CID 139905465) has the molecular formula C22H46O4 and a molecular weight of 374.61 g/mol. Its IUPAC name is 2,7-bis(tert-butylperoxy)-2,3,3,6,6,7-hexamethyloctane.
| Compound Name | 2,7-bis(tert-butylperoxy)-2,3,3,6,6,7-hexamethyloctane |
|---|---|
| PubChem CID | 139905465 |
| Molecular Formula | C22H46O4 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.34 |
| IUPAC Name | 2,7-bis(tert-butylperoxy)-2,3,3,6,6,7-hexamethyloctane |
| SMILES | CC(C)(C)OOC(C)(C)C(C)(C)CCC(C)(C)C(C)(C)OOC(C)(C)C |
| InChI | InChI=1S/C22H46O4/c1-17(2,3)23-25-21(11,12)19(7,8)15-16-20(9,10)22(13,14)26-24-18(4,5)6/h15-16H2,1-14H3 |
| InChIKey | YDAMNXHYQVOYHX-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|