C14H9F6N3O2 — CID 139907545
3-ethenyl-2-[4-(trifluoromethoxy)anilino]-6-(trifluoromethyl)pyrimidin-4-one (PubChem CID 139907545) has the molecular formula C14H9F6N3O2 and a molecular weight of 365.23 g/mol. Its IUPAC name is 3-ethenyl-2-[4-(trifluoromethoxy)anilino]-6-(trifluoromethyl)pyrimidin-4-one.
| Compound Name | 3-ethenyl-2-[4-(trifluoromethoxy)anilino]-6-(trifluoromethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 139907545 |
| Molecular Formula | C14H9F6N3O2 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 3-ethenyl-2-[4-(trifluoromethoxy)anilino]-6-(trifluoromethyl)pyrimidin-4-one |
| SMILES | C=Cn1c(Nc2ccc(OC(F)(F)F)cc2)nc(C(F)(F)F)cc1=O |
| InChI | InChI=1S/C14H9F6N3O2/c1-2-23-11(24)7-10(13(15,16)17)22-12(23)21-8-3-5-9(6-4-8)25-14(18,19)20/h2-7H,1H2,(H,21,22) |
| InChIKey | VOKSBNRSIDNMMQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |