About 2-[2-chloro-3,5-bis(trifluoromethyl)anilino]-3-propyl-6-(trifluoromethyl)pyrimidin-4-one
2-[2-chloro-3,5-bis(trifluoromethyl)anilino]-3-propyl-6-(trifluoromethyl)pyrimidin-4-one (PubChem CID 139907719) has the molecular formula C16H11ClF9N3O
and a molecular weight of 467.72 g/mol. Its IUPAC name is 2-[2-chloro-3,5-bis(trifluoromethyl)anilino]-3-propyl-6-(trifluoromethyl)pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-[2-chloro-3,5-bis(trifluoromethyl)anilino]-3-propyl-6-(trifluoromethyl)pyrimidin-4-one |
| PubChem CID | 139907719 |
| Molecular Formula | C16H11ClF9N3O |
| Molecular Weight | 467.72 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | 2-[2-chloro-3,5-bis(trifluoromethyl)anilino]-3-propyl-6-(trifluoromethyl)pyrimidin-4-one |
| SMILES | CCCn1c(Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2Cl)nc(C(F)(F)F)cc1=O |
| InChI | InChI=1S/C16H11ClF9N3O/c1-2-3-29-11(30)6-10(16(24,25)26)28-13(29)27-9-5-7(14(18,19)20)4-8(12(9)17)15(21,22)23/h4-6H,2-3H2,1H3,(H,27,28) |
| InChIKey | SEXMJZDLMFVGMV-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.72 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-chloro-3,5-bis(trifluoromethyl)anilino]-3-propyl-6-(trifluoromethyl)pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-chloro-3,5-bis(trifluoromethyl)anilino]-3-propyl-6-(trifluoromethyl)pyrimidin-4-one?
The IUPAC name of 2-[2-chloro-3,5-bis(trifluoromethyl)anilino]-3-propyl-6-(trifluoromethyl)pyrimidin-4-one (CID 139907719) is 2-[2-chloro-3,5-bis(trifluoromethyl)anilino]-3-propyl-6-(trifluoromethyl)pyrimidin-4-one.
What is the SMILES notation for 2-[2-chloro-3,5-bis(trifluoromethyl)anilino]-3-propyl-6-(trifluoromethyl)pyrimidin-4-one?
The canonical SMILES for 2-[2-chloro-3,5-bis(trifluoromethyl)anilino]-3-propyl-6-(trifluoromethyl)pyrimidin-4-one is CCCn1c(Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2Cl)nc(C(F)(F)F)cc1=O.
What is the InChIKey of 2-[2-chloro-3,5-bis(trifluoromethyl)anilino]-3-propyl-6-(trifluoromethyl)pyrimidin-4-one?
The InChIKey is SEXMJZDLMFVGMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClF9N3O/c1-2-3-29-11(30)6-10(16(24,25)26)28-13(29)27-9-5-7(14(18,19)20)4-8(12(9)17)15(21,22)23/h4-6H,2-3H2,1H3,(H,27,28).
What are the key properties of 2-[2-chloro-3,5-bis(trifluoromethyl)anilino]-3-propyl-6-(trifluoromethyl)pyrimidin-4-one?
2-[2-chloro-3,5-bis(trifluoromethyl)anilino]-3-propyl-6-(trifluoromethyl)pyrimidin-4-one has a molecular weight of 467.72 g/mol, XLogP of 6.11, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-chloro-3,5-bis(trifluoromethyl)anilino]-3-propyl-6-(trifluoromethyl)pyrimidin-4-one is sourced from PubChem (CID 139907719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).