C16H14F6IN3O — CID 162547924
2-[2,5-bis(trifluoromethyl)anilino]-3-ethyl-6-(1-iodoethyl)pyrimidin-4-one (PubChem CID 162547924) has the molecular formula C16H14F6IN3O and a molecular weight of 505.20 g/mol. Its IUPAC name is 2-[2,5-bis(trifluoromethyl)anilino]-3-ethyl-6-(1-iodoethyl)pyrimidin-4-one.
| Compound Name | 2-[2,5-bis(trifluoromethyl)anilino]-3-ethyl-6-(1-iodoethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 162547924 |
| Molecular Formula | C16H14F6IN3O |
| Molecular Weight | 505.20 g/mol |
| Exact Mass | 505.01 |
| IUPAC Name | 2-[2,5-bis(trifluoromethyl)anilino]-3-ethyl-6-(1-iodoethyl)pyrimidin-4-one |
| SMILES | CCn1c(Nc2cc(C(F)(F)F)ccc2C(F)(F)F)nc(C(C)I)cc1=O |
| InChI | InChI=1S/C16H14F6IN3O/c1-3-26-13(27)7-11(8(2)23)24-14(26)25-12-6-9(15(17,18)19)4-5-10(12)16(20,21)22/h4-8H,3H2,1-2H3,(H,24,25) |
| InChIKey | NFDOJCVKRTZUJI-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.20 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|