C13H10Cl2F3N3O — CID 18549210
2-(2,5-dichloroanilino)-3-ethyl-6-(trifluoromethyl)pyrimidin-4-one (PubChem CID 18549210) has the molecular formula C13H10Cl2F3N3O and a molecular weight of 352.14 g/mol. Its IUPAC name is 2-(2,5-dichloroanilino)-3-ethyl-6-(trifluoromethyl)pyrimidin-4-one.
| Compound Name | 2-(2,5-dichloroanilino)-3-ethyl-6-(trifluoromethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 18549210 |
| Molecular Formula | C13H10Cl2F3N3O |
| Molecular Weight | 352.14 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 2-(2,5-dichloroanilino)-3-ethyl-6-(trifluoromethyl)pyrimidin-4-one |
| SMILES | CCn1c(Nc2cc(Cl)ccc2Cl)nc(C(F)(F)F)cc1=O |
| InChI | InChI=1S/C13H10Cl2F3N3O/c1-2-21-11(22)6-10(13(16,17)18)20-12(21)19-9-5-7(14)3-4-8(9)15/h3-6H,2H2,1H3,(H,19,20) |
| InChIKey | XWESGMXRZNBNNX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.14 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |