C9H8N6 — CID 139908093
2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-7,12-diamine (PubChem CID 139908093) has the molecular formula C9H8N6 and a molecular weight of 200.21 g/mol. Its IUPAC name is 2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-7,12-diamine.
| Compound Name | 2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-7,12-diamine |
|---|---|
| PubChem CID | 139908093 |
| Molecular Formula | C9H8N6 |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-7,12-diamine |
| SMILES | Nc1ccc2nc(N)c3cncn3c2n1 |
| InChI | InChI=1S/C9H8N6/c10-7-2-1-5-9(14-7)15-4-12-3-6(15)8(11)13-5/h1-4H,(H2,10,14)(H2,11,13) |
| InChIKey | NDOLJVGMIHNFMN-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |